C24H22F6N4OS — CID 54323231
5-[[(2R,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-carbothialdehyde (PubChem CID 54323231) has the molecular formula C24H22F6N4OS and a molecular weight of 528.52 g/mol. Its IUPAC name is 5-[[(2R,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-carbothialdehyde.
| Compound Name | 5-[[(2R,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-carbothialdehyde |
|---|---|
| PubChem CID | 54323231 |
| Molecular Formula | C24H22F6N4OS |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 5-[[(2R,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidin-1-yl]methyl]-1H-1,2,4-triazole-3-carbothialdehyde |
| SMILES | FC(F)(F)c1cc(CO[C@@H]2CCCN(Cc3nc(C=S)n[nH]3)C2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F6N4OS/c25-23(26,27)17-9-15(10-18(11-17)24(28,29)30)13-35-19-7-4-8-34(12-20-31-21(14-36)33-32-20)22(19)16-5-2-1-3-6-16/h1-3,5-6,9-11,14,19,22H,4,7-8,12-13H2,(H,31,32,33)/t19-,22?/m1/s1 |
| InChIKey | STCJKBJKGDAYFL-LCQOSCCDSA-N |
| XLogP | 6.11 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|