C11H8Cl3NO3 — CID 54323517
[(2-methoxyphenyl)methylideneamino] 2,3,3-trichloroprop-2-enoate (PubChem CID 54323517) has the molecular formula C11H8Cl3NO3 and a molecular weight of 308.55 g/mol. Its IUPAC name is [(2-methoxyphenyl)methylideneamino] 2,3,3-trichloroprop-2-enoate.
| Compound Name | [(2-methoxyphenyl)methylideneamino] 2,3,3-trichloroprop-2-enoate |
|---|---|
| PubChem CID | 54323517 |
| Molecular Formula | C11H8Cl3NO3 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | [(2-methoxyphenyl)methylideneamino] 2,3,3-trichloroprop-2-enoate |
| SMILES | COc1ccccc1C=NOC(=O)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C11H8Cl3NO3/c1-17-8-5-3-2-4-7(8)6-15-18-11(16)9(12)10(13)14/h2-6H,1H3 |
| InChIKey | STHOFMBGUSXTSO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|