C22H41N5O2 — CID 54323821
4,6-dimethoxy-N-[8-(2,2,6,6-tetramethylpiperidin-4-yl)octyl]-1,3,5-triazin-2-amine (PubChem CID 54323821) has the molecular formula C22H41N5O2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4,6-dimethoxy-N-[8-(2,2,6,6-tetramethylpiperidin-4-yl)octyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-[8-(2,2,6,6-tetramethylpiperidin-4-yl)octyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54323821 |
| Molecular Formula | C22H41N5O2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | 4,6-dimethoxy-N-[8-(2,2,6,6-tetramethylpiperidin-4-yl)octyl]-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NCCCCCCCCC2CC(C)(C)NC(C)(C)C2)nc(OC)n1 |
| InChI | InChI=1S/C22H41N5O2/c1-21(2)15-17(16-22(3,4)27-21)13-11-9-7-8-10-12-14-23-18-24-19(28-5)26-20(25-18)29-6/h17,27H,7-16H2,1-6H3,(H,23,24,25,26) |
| InChIKey | STMZLMYZWCWJEZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|