C6H12O5S — CID 54323859
(2R,4R,5S)-1,4,5,6-tetrahydroxy-2-sulfanylhexan-3-one (PubChem CID 54323859) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is (2R,4R,5S)-1,4,5,6-tetrahydroxy-2-sulfanylhexan-3-one.
| Compound Name | (2R,4R,5S)-1,4,5,6-tetrahydroxy-2-sulfanylhexan-3-one |
|---|---|
| PubChem CID | 54323859 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (2R,4R,5S)-1,4,5,6-tetrahydroxy-2-sulfanylhexan-3-one |
| SMILES | O=C([C@H](S)CO)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O5S/c7-1-3(9)5(10)6(11)4(12)2-8/h3-5,7-10,12H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | STNORNIYBNENMR-VPENINKCSA-N |
| XLogP | -2.44 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|