C19H23F2NO2 — CID 54323885
(6R,8R,9S,10S,13S,14S)-4-amino-2,6-difluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 54323885) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is (6R,8R,9S,10S,13S,14S)-4-amino-2,6-difluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10S,13S,14S)-4-amino-2,6-difluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 54323885 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (6R,8R,9S,10S,13S,14S)-4-amino-2,6-difluoro-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C=C(F)C(=O)C(N)=C1[C@H](F)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H23F2NO2/c1-18-6-5-11-9(10(18)3-4-14(18)23)7-12(20)15-16(22)17(24)13(21)8-19(11,15)2/h8-12H,3-7,22H2,1-2H3/t9-,10-,11-,12+,18-,19+/m0/s1 |
| InChIKey | STOAIISZONPGDM-KNVPUBJQSA-N |
| XLogP | 3.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|