About 10-propoxydecanamide
10-propoxydecanamide (PubChem CID 54324028) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 10-propoxydecanamide.
Molecular Properties
| Compound Name | 10-propoxydecanamide |
| PubChem CID | 54324028 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 10-propoxydecanamide |
| SMILES | CCCOCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C13H27NO2/c1-2-11-16-12-9-7-5-3-4-6-8-10-13(14)15/h2-12H2,1H3,(H2,14,15) |
| InChIKey | STQIMHXSIYDPGQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-propoxydecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-propoxydecanamide?
The IUPAC name of 10-propoxydecanamide (CID 54324028) is 10-propoxydecanamide.
What is the SMILES notation for 10-propoxydecanamide?
The canonical SMILES for 10-propoxydecanamide is CCCOCCCCCCCCCC(N)=O.
What is the InChIKey of 10-propoxydecanamide?
The InChIKey is STQIMHXSIYDPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-2-11-16-12-9-7-5-3-4-6-8-10-13(14)15/h2-12H2,1H3,(H2,14,15).
What are the key properties of 10-propoxydecanamide?
10-propoxydecanamide has a molecular weight of 229.36 g/mol, XLogP of 3.02, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-propoxydecanamide is sourced from PubChem (CID 54324028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).