C18H22ClN3O — CID 54324090
1-(4-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)oct-4-en-3-one (PubChem CID 54324090) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)oct-4-en-3-one.
| Compound Name | 1-(4-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)oct-4-en-3-one |
|---|---|
| PubChem CID | 54324090 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)oct-4-en-3-one |
| SMILES | CCCC=C(C(=O)C(C)(C)Cc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C18H22ClN3O/c1-4-5-6-16(22-13-20-12-21-22)17(23)18(2,3)11-14-7-9-15(19)10-8-14/h6-10,12-13H,4-5,11H2,1-3H3 |
| InChIKey | STRNCDILXALUBJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|