C6H5F5N2O2 — CID 54324210
1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 54324210) has the molecular formula C6H5F5N2O2 and a molecular weight of 232.11 g/mol. Its IUPAC name is 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 54324210 |
| Molecular Formula | C6H5F5N2O2 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 1-[5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CC(O)c1noc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H5F5N2O2/c1-2(14)3-12-4(15-13-3)5(7,8)6(9,10)11/h2,14H,1H3 |
| InChIKey | STTSZMSMSMHWAZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|