About 2-aminobutanedinitrile
2-aminobutanedinitrile (PubChem CID 543247) has the molecular formula C4H5N3
and a molecular weight of 95.11 g/mol. Its IUPAC name is 2-aminobutanedinitrile.
Molecular Properties
| Compound Name | 2-aminobutanedinitrile |
| PubChem CID | 543247 |
| Molecular Formula | C4H5N3 |
| Molecular Weight | 95.11 g/mol |
| Exact Mass | 95.05 |
| IUPAC Name | 2-aminobutanedinitrile |
| SMILES | N#CCC(N)C#N |
| InChI | InChI=1S/C4H5N3/c5-2-1-4(7)3-6/h4H,1,7H2 |
| InChIKey | VKLBVSAOSBIXST-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.11 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminobutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedinitrile?
The IUPAC name of 2-aminobutanedinitrile (CID 543247) is 2-aminobutanedinitrile.
What is the SMILES notation for 2-aminobutanedinitrile?
The canonical SMILES for 2-aminobutanedinitrile is N#CCC(N)C#N.
What is the InChIKey of 2-aminobutanedinitrile?
The InChIKey is VKLBVSAOSBIXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3/c5-2-1-4(7)3-6/h4H,1,7H2.
What are the key properties of 2-aminobutanedinitrile?
2-aminobutanedinitrile has a molecular weight of 95.11 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedinitrile is sourced from PubChem (CID 543247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).