C24H50N4 — CID 54324719
1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,1-diamine (PubChem CID 54324719) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,1-diamine |
|---|---|
| PubChem CID | 54324719 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 1-N,1-N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,1-diamine |
| SMILES | CCCCCC(NC1CC(C)(C)NC(C)(C)C1)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H50N4/c1-10-11-12-13-20(25-18-14-21(2,3)27-22(4,5)15-18)26-19-16-23(6,7)28-24(8,9)17-19/h18-20,25-28H,10-17H2,1-9H3 |
| InChIKey | SUCHMRLZWQTGMX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|