About 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole
2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole (PubChem CID 54324823) has the molecular formula C17H30N2S
and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole.
Molecular Properties
| Compound Name | 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole |
| PubChem CID | 54324823 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole |
| SMILES | CCCCSC1(C2CCCCC2)N=C(CC)C(CC)=N1 |
| InChI | InChI=1S/C17H30N2S/c1-4-7-13-20-17(14-11-9-8-10-12-14)18-15(5-2)16(6-3)19-17/h14H,4-13H2,1-3H3 |
| InChIKey | SUEGXMVMIHHYRH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole?
The IUPAC name of 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole (CID 54324823) is 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole.
What is the SMILES notation for 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole?
The canonical SMILES for 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole is CCCCSC1(C2CCCCC2)N=C(CC)C(CC)=N1.
What is the InChIKey of 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole?
The InChIKey is SUEGXMVMIHHYRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2S/c1-4-7-13-20-17(14-11-9-8-10-12-14)18-15(5-2)16(6-3)19-17/h14H,4-13H2,1-3H3.
What are the key properties of 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole?
2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole has a molecular weight of 294.51 g/mol, XLogP of 5.47, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-2-cyclohexyl-4,5-diethylimidazole is sourced from PubChem (CID 54324823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).