About [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol
[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol (PubChem CID 54324997) has the molecular formula C23H23NO3S
and a molecular weight of 393.51 g/mol. Its IUPAC name is [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol |
| PubChem CID | 54324997 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol |
| SMILES | CC(C)(C)c1csc(-c2cc3cc(COc4ccccc4CO)ccc3o2)n1 |
| InChI | InChI=1S/C23H23NO3S/c1-23(2,3)21-14-28-22(24-21)20-11-17-10-15(8-9-19(17)27-20)13-26-18-7-5-4-6-16(18)12-25/h4-11,14,25H,12-13H2,1-3H3 |
| InChIKey | SUHFBTXESQJWOT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol?
The IUPAC name of [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol (CID 54324997) is [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol.
What is the SMILES notation for [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol?
The canonical SMILES for [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol is CC(C)(C)c1csc(-c2cc3cc(COc4ccccc4CO)ccc3o2)n1.
What is the InChIKey of [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol?
The InChIKey is SUHFBTXESQJWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO3S/c1-23(2,3)21-14-28-22(24-21)20-11-17-10-15(8-9-19(17)27-20)13-26-18-7-5-4-6-16(18)12-25/h4-11,14,25H,12-13H2,1-3H3.
What are the key properties of [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol?
[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol has a molecular weight of 393.51 g/mol, XLogP of 5.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]methanol is sourced from PubChem (CID 54324997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).