C26H27Cl2FN2O6 — CID 54325187
methyl 2-[2-[[[1-[4-[(2,2-dichlorocyclopropyl)methoxy]-2-fluorophenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 54325187) has the molecular formula C26H27Cl2FN2O6 and a molecular weight of 553.41 g/mol. Its IUPAC name is methyl 2-[2-[[[1-[4-[(2,2-dichlorocyclopropyl)methoxy]-2-fluorophenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[[1-[4-[(2,2-dichlorocyclopropyl)methoxy]-2-fluorophenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54325187 |
| Molecular Formula | C26H27Cl2FN2O6 |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | methyl 2-[2-[[[1-[4-[(2,2-dichlorocyclopropyl)methoxy]-2-fluorophenyl]-1-methoxyiminopropan-2-ylidene]amino]oxymethyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1CON=C(C)C(=NOC)c1ccc(OCC2CC2(Cl)Cl)cc1F |
| InChI | InChI=1S/C26H27Cl2FN2O6/c1-16(30-37-13-17-7-5-6-8-20(17)22(15-33-2)25(32)34-3)24(31-35-4)21-10-9-19(11-23(21)29)36-14-18-12-26(18,27)28/h5-11,15,18H,12-14H2,1-4H3 |
| InChIKey | SUKKLVJALGDLLT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|