C15H25N — CID 54325297
2,2,11,11-tetramethyl-1-azacyclododeca-4,8,12-triene (PubChem CID 54325297) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,2,11,11-tetramethyl-1-azacyclododeca-4,8,12-triene.
| Compound Name | 2,2,11,11-tetramethyl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 54325297 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,2,11,11-tetramethyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CC1(C)/C=N\C(C)(C)CC=CCCC=CC1 |
| InChI | InChI=1S/C15H25N/c1-14(2)11-9-7-5-6-8-10-12-15(3,4)16-13-14/h7-10,13H,5-6,11-12H2,1-4H3/b9-7?,10-8?,16-13- |
| InChIKey | SUMJAQKXGQGYCM-VOOUNYMWSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|