About 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one
3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one (PubChem CID 54325310) has the molecular formula C14H14Cl2N2O
and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one |
| PubChem CID | 54325310 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one |
| SMILES | CC(C)(C)c1c(Cl)cc(-c2ccc(=O)[nH]n2)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O/c1-14(2,3)13-9(15)6-8(7-10(13)16)11-4-5-12(19)18-17-11/h4-7H,1-3H3,(H,18,19) |
| InChIKey | SUMNASJMAOOTRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one?
The IUPAC name of 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one (CID 54325310) is 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one.
What is the SMILES notation for 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one?
The canonical SMILES for 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one is CC(C)(C)c1c(Cl)cc(-c2ccc(=O)[nH]n2)cc1Cl.
What is the InChIKey of 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one?
The InChIKey is SUMNASJMAOOTRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O/c1-14(2,3)13-9(15)6-8(7-10(13)16)11-4-5-12(19)18-17-11/h4-7H,1-3H3,(H,18,19).
What are the key properties of 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one?
3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one has a molecular weight of 297.19 g/mol, XLogP of 4.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butyl-3,5-dichlorophenyl)-1H-pyridazin-6-one is sourced from PubChem (CID 54325310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).