C29H56O3Si2 — CID 54325775
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-prop-2-enylcyclopentan-1-one (PubChem CID 54325775) has the molecular formula C29H56O3Si2 and a molecular weight of 508.94 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-prop-2-enylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 54325775 |
| Molecular Formula | C29H56O3Si2 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-enyl]-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)CCCC |
| InChI | InChI=1S/C29H56O3Si2/c1-14-16-18-22(3)26(31-33(10,11)28(4,5)6)20-19-24-23(17-15-2)25(30)21-27(24)32-34(12,13)29(7,8)9/h15,19-20,22-24,26-27H,2,14,16-18,21H2,1,3-13H3/t22?,23-,24-,26-,27-/m1/s1 |
| InChIKey | SUUUFDJYGQAWQU-GJOSXCIKSA-N |
| XLogP | 8.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|