About 2-methylhex-5-enenitrile
2-methylhex-5-enenitrile (PubChem CID 543258) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 2-methylhex-5-enenitrile.
Molecular Properties
| Compound Name | 2-methylhex-5-enenitrile |
| PubChem CID | 543258 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2-methylhex-5-enenitrile |
| SMILES | C=CCCC(C)C#N |
| InChI | InChI=1S/C7H11N/c1-3-4-5-7(2)6-8/h3,7H,1,4-5H2,2H3 |
| InChIKey | WSLQODBTEPJISE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-5-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-5-enenitrile?
The IUPAC name of 2-methylhex-5-enenitrile (CID 543258) is 2-methylhex-5-enenitrile.
What is the SMILES notation for 2-methylhex-5-enenitrile?
The canonical SMILES for 2-methylhex-5-enenitrile is C=CCCC(C)C#N.
What is the InChIKey of 2-methylhex-5-enenitrile?
The InChIKey is WSLQODBTEPJISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-3-4-5-7(2)6-8/h3,7H,1,4-5H2,2H3.
What are the key properties of 2-methylhex-5-enenitrile?
2-methylhex-5-enenitrile has a molecular weight of 109.17 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-5-enenitrile is sourced from PubChem (CID 543258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).