C38H54O5 — CID 54325805
methyl (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-benzoyloxy-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate (PubChem CID 54325805) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is methyl (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-benzoyloxy-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-benzoyloxy-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 54325805 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | methyl (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-benzoyloxy-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@](O)(OC(=O)c5ccccc5)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C38H54O5/c1-32(2)18-21-37(31(40)42-8)22-20-35(6)26(27(37)24-32)14-15-29-34(5)19-23-38(41,43-30(39)25-12-10-9-11-13-25)33(3,4)28(34)16-17-36(29,35)7/h9-14,27-29,41H,15-24H2,1-8H3/t27-,28?,29-,34+,35-,36-,37+,38+/m1/s1 |
| InChIKey | SUVFAIGWTSRKPD-GHCZGLDQSA-N |
| XLogP | 8.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|