C10H24N4O12S4 — CID 54325890
[7-(disulfomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methanedisulfonic acid (PubChem CID 54325890) has the molecular formula C10H24N4O12S4 and a molecular weight of 520.59 g/mol. Its IUPAC name is [7-(disulfomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methanedisulfonic acid.
| Compound Name | [7-(disulfomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methanedisulfonic acid |
|---|---|
| PubChem CID | 54325890 |
| Molecular Formula | C10H24N4O12S4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | [7-(disulfomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methanedisulfonic acid |
| SMILES | O=S(=O)(O)C(N1CCNCCN(C(S(=O)(=O)O)S(=O)(=O)O)CCNCC1)S(=O)(=O)O |
| InChI | InChI=1S/C10H24N4O12S4/c15-27(16,17)9(28(18,19)20)13-5-1-11-2-6-14(8-4-12-3-7-13)10(29(21,22)23)30(24,25)26/h9-12H,1-8H2,(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | SUXBGFFFVCDRJO-UHFFFAOYSA-N |
| XLogP | -4.10 |
| TPSA | 248.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|