C24H33N7O3 — CID 54326016
5-octyl-5-[1-[4-(2H-triazol-4-yl)phenyl]piperazin-2-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 54326016) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-octyl-5-[1-[4-(2H-triazol-4-yl)phenyl]piperazin-2-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-octyl-5-[1-[4-(2H-triazol-4-yl)phenyl]piperazin-2-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54326016 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 5-octyl-5-[1-[4-(2H-triazol-4-yl)phenyl]piperazin-2-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCC1(C2CNCCN2c2ccc(-c3cn[nH]n3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C24H33N7O3/c1-2-3-4-5-6-7-12-24(21(32)27-23(34)28-22(24)33)20-16-25-13-14-31(20)18-10-8-17(9-11-18)19-15-26-30-29-19/h8-11,15,20,25H,2-7,12-14,16H2,1H3,(H,26,29,30)(H2,27,28,32,33,34) |
| InChIKey | SUZKCIVRWMFGKL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|