C39H36N2O2 — CID 54326495
cis-(1S,2R)-2-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]-N-tritylcyclohexan-1-amine (PubChem CID 54326495) has the molecular formula C39H36N2O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]-N-tritylcyclohexan-1-amine.
| Compound Name | cis-(1S,2R)-2-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]-N-tritylcyclohexan-1-amine |
|---|---|
| PubChem CID | 54326495 |
| Molecular Formula | C39H36N2O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | cis-(1S,2R)-2-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]-N-tritylcyclohexan-1-amine |
| SMILES | c1ccc(C(N[C@H]2CCCC[C@H]2OCc2ccc(-c3nc4ccccc4o3)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H36N2O2/c1-4-14-31(15-5-1)39(32-16-6-2-7-17-32,33-18-8-3-9-19-33)41-35-21-11-12-22-36(35)42-28-29-24-26-30(27-25-29)38-40-34-20-10-13-23-37(34)43-38/h1-10,13-20,23-27,35-36,41H,11-12,21-22,28H2/t35-,36+/m0/s1 |
| InChIKey | SVHWFFSUSWZXOQ-MPQUPPDSSA-N |
| XLogP | 8.90 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|