C16H21NO — CID 54327511
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol (PubChem CID 54327511) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol.
| Compound Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol |
|---|---|
| PubChem CID | 54327511 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-ol |
| SMILES | Oc1cccc2c1C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C16H21NO/c18-15-6-3-5-12-11(15)10-14-13-4-1-2-7-16(12,13)8-9-17-14/h3,5-6,13-14,17-18H,1-2,4,7-10H2/t13-,14+,16-/m0/s1 |
| InChIKey | SVZZBABSMGVXHM-LZWOXQAQSA-N |
| XLogP | 2.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |