C13H11ClN4OS — CID 54327677
7-(chloromethyl)-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carbothioamide (PubChem CID 54327677) has the molecular formula C13H11ClN4OS and a molecular weight of 306.78 g/mol. Its IUPAC name is 7-(chloromethyl)-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carbothioamide.
| Compound Name | 7-(chloromethyl)-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carbothioamide |
|---|---|
| PubChem CID | 54327677 |
| Molecular Formula | C13H11ClN4OS |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 7-(chloromethyl)-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carbothioamide |
| SMILES | NC(=S)c1ncn2c1CNC(=O)c1c(CCl)cccc1-2 |
| InChI | InChI=1S/C13H11ClN4OS/c14-4-7-2-1-3-8-10(7)13(19)16-5-9-11(12(15)20)17-6-18(8)9/h1-3,6H,4-5H2,(H2,15,20)(H,16,19) |
| InChIKey | SWCPCYRXHAGZBF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|