C22H37N — CID 54327695
1-[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-N,N-dimethylmethanamine (PubChem CID 54327695) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is 1-[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 54327695 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 1-[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]-N,N-dimethylmethanamine |
| SMILES | CC(C)C1=CC2=CCC3[C@@](C)(CN(C)C)CCC[C@]3(C)[C@@H]2CC1 |
| InChI | InChI=1S/C22H37N/c1-16(2)17-8-10-19-18(14-17)9-11-20-21(3,15-23(5)6)12-7-13-22(19,20)4/h9,14,16,19-20H,7-8,10-13,15H2,1-6H3/t19-,20?,21-,22-/m1/s1 |
| InChIKey | SWCZHFMDKMZJNG-VTKXFCLISA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |