About (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate
(2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate (PubChem CID 54327702) has the molecular formula C12H17NO6
and a molecular weight of 271.27 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate |
| PubChem CID | 54327702 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate |
| SMILES | CC1=CC(=O)N(CCC(=O)OOOC(C)(C)C)C1=O |
| InChI | InChI=1S/C12H17NO6/c1-8-7-9(14)13(11(8)16)6-5-10(15)17-19-18-12(2,3)4/h7H,5-6H2,1-4H3 |
| InChIKey | SWDDRZVVQKSMLK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate?
The IUPAC name of (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate (CID 54327702) is (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate.
What is the SMILES notation for (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate?
The canonical SMILES for (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate is CC1=CC(=O)N(CCC(=O)OOOC(C)(C)C)C1=O.
What is the InChIKey of (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate?
The InChIKey is SWDDRZVVQKSMLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO6/c1-8-7-9(14)13(11(8)16)6-5-10(15)17-19-18-12(2,3)4/h7H,5-6H2,1-4H3.
What are the key properties of (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate?
(2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate has a molecular weight of 271.27 g/mol, XLogP of 0.90, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy 3-(3-methyl-2,5-dioxopyrrol-1-yl)propaneperoxoate is sourced from PubChem (CID 54327702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).