About ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate
ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 54327806) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 54327806 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)C1COC=N1 |
| InChI | InChI=1S/C6H9NO3/c1-2-10-6(8)5-3-9-4-7-5/h4-5H,2-3H2,1H3 |
| InChIKey | UCIVDFOMQXEGMO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate (CID 54327806) is ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate is CCOC(=O)C1COC=N1.
What is the InChIKey of ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is UCIVDFOMQXEGMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-10-6(8)5-3-9-4-7-5/h4-5H,2-3H2,1H3.
What are the key properties of ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate?
ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 143.14 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 54327806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).