About [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate
[(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate (PubChem CID 54328268) has the molecular formula C7H11N3O3S
and a molecular weight of 217.25 g/mol. Its IUPAC name is [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate |
| PubChem CID | 54328268 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C1SC(C)C(=O)N1C |
| InChI | InChI=1S/C7H11N3O3S/c1-4-5(11)10(3)6(14-4)9-13-7(12)8-2/h4H,1-3H3,(H,8,12) |
| InChIKey | SWMPYGYFSRDKCQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate?
The IUPAC name of [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate (CID 54328268) is [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate.
What is the SMILES notation for [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate?
The canonical SMILES for [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate is CNC(=O)ON=C1SC(C)C(=O)N1C.
What is the InChIKey of [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate?
The InChIKey is SWMPYGYFSRDKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3S/c1-4-5(11)10(3)6(14-4)9-13-7(12)8-2/h4H,1-3H3,(H,8,12).
What are the key properties of [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate?
[(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate has a molecular weight of 217.25 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino] N-methylcarbamate is sourced from PubChem (CID 54328268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).