About 2-bromo-4-chlorothieno[2,3-b]pyridine
2-bromo-4-chlorothieno[2,3-b]pyridine (PubChem CID 54328394) has the molecular formula C7H3BrClNS
and a molecular weight of 248.53 g/mol. Its IUPAC name is 2-bromo-4-chlorothieno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-bromo-4-chlorothieno[2,3-b]pyridine |
| PubChem CID | 54328394 |
| Molecular Formula | C7H3BrClNS |
| Molecular Weight | 248.53 g/mol |
| Exact Mass | 246.89 |
| IUPAC Name | 2-bromo-4-chlorothieno[2,3-b]pyridine |
| SMILES | Clc1ccnc2sc(Br)cc12 |
| InChI | InChI=1S/C7H3BrClNS/c8-6-3-4-5(9)1-2-10-7(4)11-6/h1-3H |
| InChIKey | SWOSNJUCGRKUBX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-4-chlorothieno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-chlorothieno[2,3-b]pyridine?
The IUPAC name of 2-bromo-4-chlorothieno[2,3-b]pyridine (CID 54328394) is 2-bromo-4-chlorothieno[2,3-b]pyridine.
What is the SMILES notation for 2-bromo-4-chlorothieno[2,3-b]pyridine?
The canonical SMILES for 2-bromo-4-chlorothieno[2,3-b]pyridine is Clc1ccnc2sc(Br)cc12.
What is the InChIKey of 2-bromo-4-chlorothieno[2,3-b]pyridine?
The InChIKey is SWOSNJUCGRKUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClNS/c8-6-3-4-5(9)1-2-10-7(4)11-6/h1-3H.
What are the key properties of 2-bromo-4-chlorothieno[2,3-b]pyridine?
2-bromo-4-chlorothieno[2,3-b]pyridine has a molecular weight of 248.53 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-chlorothieno[2,3-b]pyridine is sourced from PubChem (CID 54328394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).