C22H29NO4 — CID 54328620
[3,7-dimethyl-9-(2,4,6-trimethyl-3-nitrophenyl)nona-2,6,8-trienyl] acetate (PubChem CID 54328620) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,4,6-trimethyl-3-nitrophenyl)nona-2,6,8-trienyl] acetate.
| Compound Name | [3,7-dimethyl-9-(2,4,6-trimethyl-3-nitrophenyl)nona-2,6,8-trienyl] acetate |
|---|---|
| PubChem CID | 54328620 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [3,7-dimethyl-9-(2,4,6-trimethyl-3-nitrophenyl)nona-2,6,8-trienyl] acetate |
| SMILES | CC(=O)OCC=C(C)CCC=C(C)C=Cc1c(C)cc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C22H29NO4/c1-15(8-7-9-16(2)12-13-27-20(6)24)10-11-21-17(3)14-18(4)22(19(21)5)23(25)26/h8,10-12,14H,7,9,13H2,1-6H3 |
| InChIKey | SWSWUJUTKZZBSG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|