About 3,4,5-triphenyl-2H-tetrazole
3,4,5-triphenyl-2H-tetrazole (PubChem CID 54329627) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is 3,4,5-triphenyl-2H-tetrazole.
Molecular Properties
| Compound Name | 3,4,5-triphenyl-2H-tetrazole |
| PubChem CID | 54329627 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3,4,5-triphenyl-2H-tetrazole |
| SMILES | c1ccc(C2=NNN(c3ccccc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16N4/c1-4-10-16(11-5-1)19-20-21-23(18-14-8-3-9-15-18)22(19)17-12-6-2-7-13-17/h1-15,21H |
| InChIKey | SXKNPESHSYSRCS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4,5-triphenyl-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-triphenyl-2H-tetrazole?
The IUPAC name of 3,4,5-triphenyl-2H-tetrazole (CID 54329627) is 3,4,5-triphenyl-2H-tetrazole.
What is the SMILES notation for 3,4,5-triphenyl-2H-tetrazole?
The canonical SMILES for 3,4,5-triphenyl-2H-tetrazole is c1ccc(C2=NNN(c3ccccc3)N2c2ccccc2)cc1.
What is the InChIKey of 3,4,5-triphenyl-2H-tetrazole?
The InChIKey is SXKNPESHSYSRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4/c1-4-10-16(11-5-1)19-20-21-23(18-14-8-3-9-15-18)22(19)17-12-6-2-7-13-17/h1-15,21H.
What are the key properties of 3,4,5-triphenyl-2H-tetrazole?
3,4,5-triphenyl-2H-tetrazole has a molecular weight of 300.37 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-triphenyl-2H-tetrazole is sourced from PubChem (CID 54329627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).