C14H18N4O5S2 — CID 54329915
(6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylidenecarbamothioylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54329915) has the molecular formula C14H18N4O5S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylidenecarbamothioylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylidenecarbamothioylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54329915 |
| Molecular Formula | C14H18N4O5S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylidenecarbamothioylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=S)N=CN(C)C)[C@H]2SC1 |
| InChI | InChI=1S/C14H18N4O5S2/c1-7(19)23-4-8-5-25-12-9(16-14(24)15-6-17(2)3)11(20)18(12)10(8)13(21)22/h6,9,12H,4-5H2,1-3H3,(H,16,24)(H,21,22)/t9-,12-/m1/s1 |
| InChIKey | SXPPJCZNPSYSSF-BXKDBHETSA-N |
| XLogP | -0.36 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|