About 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid
2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid (PubChem CID 54330451) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid |
| PubChem CID | 54330451 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid |
| SMILES | O=C(O)CNC(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C9H11NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H,10,13)(H,11,12) |
| InChIKey | SXZANLFSZHEGOK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The IUPAC name of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid (CID 54330451) is 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid.
What is the SMILES notation for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The canonical SMILES for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid is O=C(O)CNC(=O)C1=CCCC=C1.
What is the InChIKey of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The InChIKey is SXZANLFSZHEGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H,10,13)(H,11,12).
What are the key properties of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid has a molecular weight of 181.19 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid is sourced from PubChem (CID 54330451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).