2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid

C9H11NO3 — CID 54330451

IUPAC2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid
SMILESO=C(O)CNC(=O)C1=CCCC=C1
InChIInChI=1S/C9H11NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H,10,13)(H,11,12)
InChIKeySXZANLFSZHEGOK-UHFFFAOYSA-N
MW181.19 g/mol
LogP0.46
Rot. Bonds3

About 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid

2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid (PubChem CID 54330451) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid.

Molecular Properties

Compound Name2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid
PubChem CID54330451
Molecular FormulaC9H11NO3
Molecular Weight181.19 g/mol
Exact Mass181.07
IUPAC Name2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid
SMILESO=C(O)CNC(=O)C1=CCCC=C1
InChIInChI=1S/C9H11NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H,10,13)(H,11,12)
InChIKeySXZANLFSZHEGOK-UHFFFAOYSA-N
XLogP0.46
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The IUPAC name of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid (CID 54330451) is 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid.
What is the SMILES notation for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The canonical SMILES for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid is O=C(O)CNC(=O)C1=CCCC=C1.
What is the InChIKey of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
The InChIKey is SXZANLFSZHEGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h2,4-5H,1,3,6H2,(H,10,13)(H,11,12).
What are the key properties of 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid?
2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid has a molecular weight of 181.19 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-diene-1-carbonylamino)acetic acid is sourced from PubChem (CID 54330451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).