C21H29N — CID 54330566
1-octyl-1,2,3,4-tetrahydroacridine (PubChem CID 54330566) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-octyl-1,2,3,4-tetrahydroacridine.
| Compound Name | 1-octyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 54330566 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-octyl-1,2,3,4-tetrahydroacridine |
| SMILES | CCCCCCCCC1CCCc2nc3ccccc3cc21 |
| InChI | InChI=1S/C21H29N/c1-2-3-4-5-6-7-11-17-13-10-15-21-19(17)16-18-12-8-9-14-20(18)22-21/h8-9,12,14,16-17H,2-7,10-11,13,15H2,1H3 |
| InChIKey | AJWHKLKGTXTTMZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|