About methyl octadec-7-enoate
methyl octadec-7-enoate (PubChem CID 543314) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is methyl octadec-7-enoate.
Molecular Properties
| Compound Name | methyl octadec-7-enoate |
| PubChem CID | 543314 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | methyl octadec-7-enoate |
| SMILES | CCCCCCCCCCC=CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h12-13H,3-11,14-18H2,1-2H3 |
| InChIKey | XMONTNNUOWTMGE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl octadec-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl octadec-7-enoate?
The IUPAC name of methyl octadec-7-enoate (CID 543314) is methyl octadec-7-enoate.
What is the SMILES notation for methyl octadec-7-enoate?
The canonical SMILES for methyl octadec-7-enoate is CCCCCCCCCCC=CCCCCCC(=O)OC.
What is the InChIKey of methyl octadec-7-enoate?
The InChIKey is XMONTNNUOWTMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h12-13H,3-11,14-18H2,1-2H3.
What are the key properties of methyl octadec-7-enoate?
methyl octadec-7-enoate has a molecular weight of 296.50 g/mol, XLogP of 6.20, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl octadec-7-enoate is sourced from PubChem (CID 543314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).