C20H23NO — CID 54331708
[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]methanol (PubChem CID 54331708) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is [methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]methanol.
| Compound Name | [methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]methanol |
|---|---|
| PubChem CID | 54331708 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]methanol |
| SMILES | CN(CO)CCC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H23NO/c1-21(15-22)14-6-11-20-18-9-4-2-7-16(18)12-13-17-8-3-5-10-19(17)20/h2-5,7-11,22H,6,12-15H2,1H3 |
| InChIKey | SYUJOLQSKQWVHV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|