C22H26N2O2 — CID 54332283
4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]aniline (PubChem CID 54332283) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]aniline.
| Compound Name | 4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]aniline |
|---|---|
| PubChem CID | 54332283 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-[(4aR,10bR)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]aniline |
| SMILES | CCOc1cc2c(cc1OC)C(c1ccc(N)cc1)=N[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C22H26N2O2/c1-3-26-21-12-17-16-6-4-5-7-19(16)24-22(18(17)13-20(21)25-2)14-8-10-15(23)11-9-14/h8-13,16,19H,3-7,23H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | SZEGKEQICKOILT-VQIMIIECSA-N |
| XLogP | 4.55 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|