C17H18N6OS — CID 5433375
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-[(E)-1-phenylethylideneamino]acetamide (PubChem CID 5433375) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-[(E)-1-phenylethylideneamino]acetamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-[(E)-1-phenylethylideneamino]acetamide |
|---|---|
| PubChem CID | 5433375 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-[(E)-1-phenylethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CSc1nc2nc(C)cc(C)n2n1)c1ccccc1 |
| InChI | InChI=1S/C17H18N6OS/c1-11-9-12(2)23-16(18-11)19-17(22-23)25-10-15(24)21-20-13(3)14-7-5-4-6-8-14/h4-9H,10H2,1-3H3,(H,21,24)/b20-13+ |
| InChIKey | RVGOYHAGDRPTRB-DEDYPNTBSA-N |
| XLogP | 2.37 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|