About 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one
5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one (PubChem CID 54334231) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one.
Molecular Properties
| Compound Name | 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one |
| PubChem CID | 54334231 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one |
| SMILES | CN1CCc2ncoc2C1=O |
| InChI | InChI=1S/C7H8N2O2/c1-9-3-2-5-6(7(9)10)11-4-8-5/h4H,2-3H2,1H3 |
| InChIKey | TUHYEVVVCSOESP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one?
The IUPAC name of 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one (CID 54334231) is 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one.
What is the SMILES notation for 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one?
The canonical SMILES for 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one is CN1CCc2ncoc2C1=O.
What is the InChIKey of 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one?
The InChIKey is TUHYEVVVCSOESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-9-3-2-5-6(7(9)10)11-4-8-5/h4H,2-3H2,1H3.
What are the key properties of 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one?
5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one has a molecular weight of 152.15 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,7-dihydro-[1,3]oxazolo[5,4-c]pyridin-4-one is sourced from PubChem (CID 54334231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).