About 3-ethylpentylhydrazine
3-ethylpentylhydrazine (PubChem CID 54334312) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is 3-ethylpentylhydrazine.
Molecular Properties
| Compound Name | 3-ethylpentylhydrazine |
| PubChem CID | 54334312 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | 3-ethylpentylhydrazine |
| SMILES | CCC(CC)CCNN |
| InChI | InChI=1S/C7H18N2/c1-3-7(4-2)5-6-9-8/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | TUJDZBCXUPOERQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpentylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentylhydrazine?
The IUPAC name of 3-ethylpentylhydrazine (CID 54334312) is 3-ethylpentylhydrazine.
What is the SMILES notation for 3-ethylpentylhydrazine?
The canonical SMILES for 3-ethylpentylhydrazine is CCC(CC)CCNN.
What is the InChIKey of 3-ethylpentylhydrazine?
The InChIKey is TUJDZBCXUPOERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2/c1-3-7(4-2)5-6-9-8/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 3-ethylpentylhydrazine?
3-ethylpentylhydrazine has a molecular weight of 130.23 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentylhydrazine is sourced from PubChem (CID 54334312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).