About 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate
1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate (PubChem CID 54334457) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate.
Molecular Properties
| Compound Name | 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate |
| PubChem CID | 54334457 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate |
| SMILES | CCC(OC(=O)c1c(C)nc2n(C)c3ccccc3n12)N(C)C |
| InChI | InChI=1S/C17H22N4O2/c1-6-14(19(3)4)23-16(22)15-11(2)18-17-20(5)12-9-7-8-10-13(12)21(15)17/h7-10,14H,6H2,1-5H3 |
| InChIKey | TULSSURJFWZPQI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate?
The IUPAC name of 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate (CID 54334457) is 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate.
What is the SMILES notation for 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate?
The canonical SMILES for 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate is CCC(OC(=O)c1c(C)nc2n(C)c3ccccc3n12)N(C)C.
What is the InChIKey of 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate?
The InChIKey is TULSSURJFWZPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-6-14(19(3)4)23-16(22)15-11(2)18-17-20(5)12-9-7-8-10-13(12)21(15)17/h7-10,14H,6H2,1-5H3.
What are the key properties of 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate?
1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate has a molecular weight of 314.39 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)propyl 2,4-dimethylimidazo[1,2-a]benzimidazole-1-carboxylate is sourced from PubChem (CID 54334457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).