About 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one
4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 54334483) has the molecular formula C17H22F3NO2
and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| PubChem CID | 54334483 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | CCCCCC1(C(F)(F)F)OC(=O)Nc2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C17H22F3NO2/c1-4-5-6-9-16(17(18,19)20)13-10-12(11(2)3)7-8-14(13)21-15(22)23-16/h7-8,10-11H,4-6,9H2,1-3H3,(H,21,22) |
| InChIKey | TUMGSNURXQDEOZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The IUPAC name of 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CID 54334483) is 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
What is the SMILES notation for 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The canonical SMILES for 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is CCCCCC1(C(F)(F)F)OC(=O)Nc2ccc(C(C)C)cc21.
What is the InChIKey of 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The InChIKey is TUMGSNURXQDEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F3NO2/c1-4-5-6-9-16(17(18,19)20)13-10-12(11(2)3)7-8-14(13)21-15(22)23-16/h7-8,10-11H,4-6,9H2,1-3H3,(H,21,22).
What are the key properties of 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one has a molecular weight of 329.36 g/mol, XLogP of 5.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-6-propan-2-yl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is sourced from PubChem (CID 54334483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).