C21H6Cl10O4 — CID 54334724
2-[2,3-bis(2,3,4,5,6-pentachlorophenyl)phenyl]propanedioic acid (PubChem CID 54334724) has the molecular formula C21H6Cl10O4 and a molecular weight of 676.80 g/mol. Its IUPAC name is 2-[2,3-bis(2,3,4,5,6-pentachlorophenyl)phenyl]propanedioic acid.
| Compound Name | 2-[2,3-bis(2,3,4,5,6-pentachlorophenyl)phenyl]propanedioic acid |
|---|---|
| PubChem CID | 54334724 |
| Molecular Formula | C21H6Cl10O4 |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 671.72 |
| IUPAC Name | 2-[2,3-bis(2,3,4,5,6-pentachlorophenyl)phenyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1cccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C21H6Cl10O4/c22-10-7(11(23)15(27)18(30)14(10)26)4-2-1-3-5(8(20(32)33)21(34)35)6(4)9-12(24)16(28)19(31)17(29)13(9)25/h1-3,8H,(H,32,33)(H,34,35) |
| InChIKey | TUQLKIISSKCICK-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|