C14H22ClF — CID 54334840
5-(chloromethylidene)-7-fluoro-6,6,9-trimethyldeca-2,7-diene (PubChem CID 54334840) has the molecular formula C14H22ClF and a molecular weight of 244.78 g/mol. Its IUPAC name is 5-(chloromethylidene)-7-fluoro-6,6,9-trimethyldeca-2,7-diene.
| Compound Name | 5-(chloromethylidene)-7-fluoro-6,6,9-trimethyldeca-2,7-diene |
|---|---|
| PubChem CID | 54334840 |
| Molecular Formula | C14H22ClF |
| Molecular Weight | 244.78 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 5-(chloromethylidene)-7-fluoro-6,6,9-trimethyldeca-2,7-diene |
| SMILES | CC=CCC(=CCl)C(C)(C)C(F)=CC(C)C |
| InChI | InChI=1S/C14H22ClF/c1-6-7-8-12(10-15)14(4,5)13(16)9-11(2)3/h6-7,9-11H,8H2,1-5H3 |
| InChIKey | FTMYKJPQSLXBKG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.78 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|