C12H10Br5N3O3S — CID 54334871
N-diazo-3-(2,3,4,5,6-pentabromocyclohexyl)oxybenzenesulfonamide (PubChem CID 54334871) has the molecular formula C12H10Br5N3O3S and a molecular weight of 675.82 g/mol. Its IUPAC name is N-diazo-3-(2,3,4,5,6-pentabromocyclohexyl)oxybenzenesulfonamide.
| Compound Name | N-diazo-3-(2,3,4,5,6-pentabromocyclohexyl)oxybenzenesulfonamide |
|---|---|
| PubChem CID | 54334871 |
| Molecular Formula | C12H10Br5N3O3S |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 670.64 |
| IUPAC Name | N-diazo-3-(2,3,4,5,6-pentabromocyclohexyl)oxybenzenesulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1cccc(OC2C(Br)C(Br)C(Br)C(Br)C2Br)c1 |
| InChI | InChI=1S/C12H10Br5N3O3S/c13-7-8(14)10(16)12(11(17)9(7)15)23-5-2-1-3-6(4-5)24(21,22)20-19-18/h1-4,7-12H |
| InChIKey | TUSXWMXOWKFZGH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|