About 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride
5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride (PubChem CID 54335107) has the molecular formula C6HBrCl2N2O10S3
and a molecular weight of 508.09 g/mol. Its IUPAC name is 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride.
Molecular Properties
| Compound Name | 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride |
| PubChem CID | 54335107 |
| Molecular Formula | C6HBrCl2N2O10S3 |
| Molecular Weight | 508.09 g/mol |
| Exact Mass | 505.74 |
| IUPAC Name | 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride |
| SMILES | O=[N+]([O-])c1c(S(=O)(=O)Cl)cc(S(=O)(=O)Br)c([N+](=O)[O-])c1S(=O)(=O)Cl |
| InChI | InChI=1S/C6HBrCl2N2O10S3/c7-22(16,17)2-1-3(23(8,18)19)5(11(14)15)6(24(9,20)21)4(2)10(12)13/h1H |
| InChIKey | TUXOWXLOMFCLGX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 188.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.09 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride?
The IUPAC name of 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride (CID 54335107) is 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride.
What is the SMILES notation for 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride?
The canonical SMILES for 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride is O=[N+]([O-])c1c(S(=O)(=O)Cl)cc(S(=O)(=O)Br)c([N+](=O)[O-])c1S(=O)(=O)Cl.
What is the InChIKey of 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride?
The InChIKey is TUXOWXLOMFCLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBrCl2N2O10S3/c7-22(16,17)2-1-3(23(8,18)19)5(11(14)15)6(24(9,20)21)4(2)10(12)13/h1H.
What are the key properties of 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride?
5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride has a molecular weight of 508.09 g/mol, XLogP of 1.44, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromosulfonyl-2,4-dinitrobenzene-1,3-disulfonyl chloride is sourced from PubChem (CID 54335107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).