C11H9F13O — CID 54335571
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-pent-1-en-3-yloxyhexane (PubChem CID 54335571) has the molecular formula C11H9F13O and a molecular weight of 404.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-pent-1-en-3-yloxyhexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-pent-1-en-3-yloxyhexane |
|---|---|
| PubChem CID | 54335571 |
| Molecular Formula | C11H9F13O |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-pent-1-en-3-yloxyhexane |
| SMILES | C=CC(CC)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F13O/c1-3-5(4-2)25-11(23,24)9(18,19)7(14,15)6(12,13)8(16,17)10(20,21)22/h3,5H,1,4H2,2H3 |
| InChIKey | TVFVHPGJZAUFCG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|