C10H18F6 — CID 54335721
2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane (PubChem CID 54335721) has the molecular formula C10H18F6 and a molecular weight of 252.24 g/mol. Its IUPAC name is 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane.
| Compound Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane |
|---|---|
| PubChem CID | 54335721 |
| Molecular Formula | C10H18F6 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2,2-dimethylpropane;1,1,1,3,3,3-hexafluoro-2,2-dimethylpropane |
| SMILES | CC(C)(C(F)(F)F)C(F)(F)F.CC(C)(C)C |
| InChI | InChI=1S/C5H6F6.C5H12/c1-3(2,4(6,7)8)5(9,10)11;1-5(2,3)4/h1-2H3;1-4H3 |
| InChIKey | TVIHGDVMIZTTIG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |