C19H11Cl6N3 — CID 54337424
2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 54337424) has the molecular formula C19H11Cl6N3 and a molecular weight of 494.04 g/mol. Its IUPAC name is 2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 54337424 |
| Molecular Formula | C19H11Cl6N3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 490.91 |
| IUPAC Name | 2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccc(C=Cc3ccccc3)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C19H11Cl6N3/c20-18(21,22)16-26-15(27-17(28-16)19(23,24)25)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H |
| InChIKey | TWMGONWXQSKRMH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|