C20H35F2NO4 — CID 54337876
5-(4,4-difluoro-3-hydroxy-3-methyloct-1-enyl)-1-(2,7-dihydroxyheptyl)pyrrolidin-2-one (PubChem CID 54337876) has the molecular formula C20H35F2NO4 and a molecular weight of 391.50 g/mol. Its IUPAC name is 5-(4,4-difluoro-3-hydroxy-3-methyloct-1-enyl)-1-(2,7-dihydroxyheptyl)pyrrolidin-2-one.
| Compound Name | 5-(4,4-difluoro-3-hydroxy-3-methyloct-1-enyl)-1-(2,7-dihydroxyheptyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 54337876 |
| Molecular Formula | C20H35F2NO4 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 5-(4,4-difluoro-3-hydroxy-3-methyloct-1-enyl)-1-(2,7-dihydroxyheptyl)pyrrolidin-2-one |
| SMILES | CCCCC(F)(F)C(C)(O)C=CC1CCC(=O)N1CC(O)CCCCCO |
| InChI | InChI=1S/C20H35F2NO4/c1-3-4-12-20(21,22)19(2,27)13-11-16-9-10-18(26)23(16)15-17(25)8-6-5-7-14-24/h11,13,16-17,24-25,27H,3-10,12,14-15H2,1-2H3 |
| InChIKey | TWUOSBAEEFZLMQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|