About [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate
[1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate (PubChem CID 54338423) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate |
| PubChem CID | 54338423 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate |
| SMILES | CCC(N)C(=O)OC(C)(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO2/c1-4-12(16)13(17)18-14(2,3)9-10-5-7-11(15)8-6-10/h5-8,12H,4,9,16H2,1-3H3 |
| InChIKey | TXEOHHOOSQIDSA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate?
The IUPAC name of [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate (CID 54338423) is [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate.
What is the SMILES notation for [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate?
The canonical SMILES for [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate is CCC(N)C(=O)OC(C)(C)Cc1ccc(F)cc1.
What is the InChIKey of [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate?
The InChIKey is TXEOHHOOSQIDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-4-12(16)13(17)18-14(2,3)9-10-5-7-11(15)8-6-10/h5-8,12H,4,9,16H2,1-3H3.
What are the key properties of [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate?
[1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate has a molecular weight of 253.32 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-2-methylpropan-2-yl] 2-aminobutanoate is sourced from PubChem (CID 54338423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).